C11H12F4N2O3 — CID 16658947
(2R)-2-[2-fluoro-4-nitro-N-(2,2,2-trifluoroethyl)anilino]propan-1-ol (PubChem CID 16658947) has the molecular formula C11H12F4N2O3 and a molecular weight of 296.22 g/mol. Its IUPAC name is (2R)-2-[2-fluoro-4-nitro-N-(2,2,2-trifluoroethyl)anilino]propan-1-ol.
| Compound Name | (2R)-2-[2-fluoro-4-nitro-N-(2,2,2-trifluoroethyl)anilino]propan-1-ol |
|---|---|
| PubChem CID | 16658947 |
| Molecular Formula | C11H12F4N2O3 |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (2R)-2-[2-fluoro-4-nitro-N-(2,2,2-trifluoroethyl)anilino]propan-1-ol |
| SMILES | C[C@H](CO)N(CC(F)(F)F)c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C11H12F4N2O3/c1-7(5-18)16(6-11(13,14)15)10-3-2-8(17(19)20)4-9(10)12/h2-4,7,18H,5-6H2,1H3/t7-/m1/s1 |
| InChIKey | DOPBWCPXMCZZLL-SSDOTTSWSA-N |
| XLogP | 2.48 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|