C8H10FN3O4S — CID 62151022
2-amino-6-fluoro-N,N-dimethyl-4-nitrobenzenesulfonamide (PubChem CID 62151022) has the molecular formula C8H10FN3O4S and a molecular weight of 263.25 g/mol. Its IUPAC name is 2-amino-6-fluoro-N,N-dimethyl-4-nitrobenzenesulfonamide.
| Compound Name | 2-amino-6-fluoro-N,N-dimethyl-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 62151022 |
| Molecular Formula | C8H10FN3O4S |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-amino-6-fluoro-N,N-dimethyl-4-nitrobenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1c(N)cc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C8H10FN3O4S/c1-11(2)17(15,16)8-6(9)3-5(12(13)14)4-7(8)10/h3-4H,10H2,1-2H3 |
| InChIKey | USROYJWTDJZJCP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|