C11H15Cl2N3O2 — CID 133485160
N'-(2,6-dichloro-4-nitrophenyl)-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 133485160) has the molecular formula C11H15Cl2N3O2 and a molecular weight of 292.17 g/mol. Its IUPAC name is N'-(2,6-dichloro-4-nitrophenyl)-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-(2,6-dichloro-4-nitrophenyl)-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 133485160 |
| Molecular Formula | C11H15Cl2N3O2 |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | N'-(2,6-dichloro-4-nitrophenyl)-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)c1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C11H15Cl2N3O2/c1-14(2)4-5-15(3)11-9(12)6-8(16(17)18)7-10(11)13/h6-7H,4-5H2,1-3H3 |
| InChIKey | AFHATFQDJQXELQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|