C20H31ClN10O8 — CID 159484828
2-chloro-3,5-dinitropyridine;N'-(3,5-dinitro-2-pyridinyl)-N,N,N'-trimethylethane-1,2-diamine;N,N',N'-trimethylethane-1,2-diamine (PubChem CID 159484828) has the molecular formula C20H31ClN10O8 and a molecular weight of 574.98 g/mol. Its IUPAC name is 2-chloro-3,5-dinitropyridine;N'-(3,5-dinitro-2-pyridinyl)-N,N,N'-trimethylethane-1,2-diamine;N,N',N'-trimethylethane-1,2-diamine.
| Compound Name | 2-chloro-3,5-dinitropyridine;N'-(3,5-dinitro-2-pyridinyl)-N,N,N'-trimethylethane-1,2-diamine;N,N',N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 159484828 |
| Molecular Formula | C20H31ClN10O8 |
| Molecular Weight | 574.98 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | 2-chloro-3,5-dinitropyridine;N'-(3,5-dinitro-2-pyridinyl)-N,N,N'-trimethylethane-1,2-diamine;N,N',N'-trimethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)c1ncc([N+](=O)[O-])cc1[N+](=O)[O-].CNCCN(C)C.O=[N+]([O-])c1cnc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H15N5O4.C5H2ClN3O4.C5H14N2/c1-12(2)4-5-13(3)10-9(15(18)19)6-8(7-11-10)14(16)17;6-5-4(9(12)13)1-3(2-7-5)8(10)11;1-6-4-5-7(2)3/h6-7H,4-5H2,1-3H3;1-2H;6H,4-5H2,1-3H3 |
| InChIKey | LXLKJZLJSHVNCB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 220.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.98 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|