C11H16N4O4 — CID 66221146
N'-[(2,4-dinitrophenyl)methyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 66221146) has the molecular formula C11H16N4O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is N'-[(2,4-dinitrophenyl)methyl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[(2,4-dinitrophenyl)methyl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 66221146 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N'-[(2,4-dinitrophenyl)methyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNCCN(C)Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16N4O4/c1-12-5-6-13(2)8-9-3-4-10(14(16)17)7-11(9)15(18)19/h3-4,7,12H,5-6,8H2,1-2H3 |
| InChIKey | LROGEAWOXSVHJO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|