C11H15N3O5 — CID 82724203
1-(2,4-dinitrophenyl)-N-[(2-methylpropan-2-yl)oxy]methanamine (PubChem CID 82724203) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-N-[(2-methylpropan-2-yl)oxy]methanamine.
| Compound Name | 1-(2,4-dinitrophenyl)-N-[(2-methylpropan-2-yl)oxy]methanamine |
|---|---|
| PubChem CID | 82724203 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-N-[(2-methylpropan-2-yl)oxy]methanamine |
| SMILES | CC(C)(C)ONCc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15N3O5/c1-11(2,3)19-12-7-8-4-5-9(13(15)16)6-10(8)14(17)18/h4-6,12H,7H2,1-3H3 |
| InChIKey | FYWLFSLFYOHZTN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|