C13H10ClN3O4 — CID 66221122
4-chloro-N-[(2,4-dinitrophenyl)methyl]aniline (PubChem CID 66221122) has the molecular formula C13H10ClN3O4 and a molecular weight of 307.69 g/mol. Its IUPAC name is 4-chloro-N-[(2,4-dinitrophenyl)methyl]aniline.
| Compound Name | 4-chloro-N-[(2,4-dinitrophenyl)methyl]aniline |
|---|---|
| PubChem CID | 66221122 |
| Molecular Formula | C13H10ClN3O4 |
| Molecular Weight | 307.69 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 4-chloro-N-[(2,4-dinitrophenyl)methyl]aniline |
| SMILES | O=[N+]([O-])c1ccc(CNc2ccc(Cl)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10ClN3O4/c14-10-2-4-11(5-3-10)15-8-9-1-6-12(16(18)19)7-13(9)17(20)21/h1-7,15H,8H2 |
| InChIKey | KCUPXNCQZBMKDI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.69 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|