C20H16ClN3O6 — CID 126187480
4-chloro-N-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methyl]aniline (PubChem CID 126187480) has the molecular formula C20H16ClN3O6 and a molecular weight of 429.82 g/mol. Its IUPAC name is 4-chloro-N-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methyl]aniline.
| Compound Name | 4-chloro-N-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methyl]aniline |
|---|---|
| PubChem CID | 126187480 |
| Molecular Formula | C20H16ClN3O6 |
| Molecular Weight | 429.82 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 4-chloro-N-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methyl]aniline |
| SMILES | COc1cc(CNc2ccc(Cl)cc2)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16ClN3O6/c1-29-20-10-13(12-22-15-5-3-14(21)4-6-15)2-8-19(20)30-18-9-7-16(23(25)26)11-17(18)24(27)28/h2-11,22H,12H2,1H3 |
| InChIKey | ZDUNOPCBGKZHTN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.82 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|