C11H14N2O4S2 — CID 134881378
1-[2,2-bis(methylsulfanyl)propyl]-2,4-dinitrobenzene (PubChem CID 134881378) has the molecular formula C11H14N2O4S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-[2,2-bis(methylsulfanyl)propyl]-2,4-dinitrobenzene.
| Compound Name | 1-[2,2-bis(methylsulfanyl)propyl]-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 134881378 |
| Molecular Formula | C11H14N2O4S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 1-[2,2-bis(methylsulfanyl)propyl]-2,4-dinitrobenzene |
| SMILES | CSC(C)(Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])SC |
| InChI | InChI=1S/C11H14N2O4S2/c1-11(18-2,19-3)7-8-4-5-9(12(14)15)6-10(8)13(16)17/h4-6H,7H2,1-3H3 |
| InChIKey | PPYRYHFMSQLUGB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|