C12H17N3O5 — CID 79389346
1-[(2,4-dinitrophenyl)methyl-methylamino]-2-methylpropan-2-ol (PubChem CID 79389346) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 1-[(2,4-dinitrophenyl)methyl-methylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[(2,4-dinitrophenyl)methyl-methylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 79389346 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-[(2,4-dinitrophenyl)methyl-methylamino]-2-methylpropan-2-ol |
| SMILES | CN(Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])CC(C)(C)O |
| InChI | InChI=1S/C12H17N3O5/c1-12(2,16)8-13(3)7-9-4-5-10(14(17)18)6-11(9)15(19)20/h4-6,16H,7-8H2,1-3H3 |
| InChIKey | MLXANHBPZYOKMQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|