C13H19BrN2O3 — CID 114382521
1-[(4-bromo-2-nitrophenyl)methyl-ethylamino]-2-methylpropan-2-ol (PubChem CID 114382521) has the molecular formula C13H19BrN2O3 and a molecular weight of 331.21 g/mol. Its IUPAC name is 1-[(4-bromo-2-nitrophenyl)methyl-ethylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[(4-bromo-2-nitrophenyl)methyl-ethylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 114382521 |
| Molecular Formula | C13H19BrN2O3 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 1-[(4-bromo-2-nitrophenyl)methyl-ethylamino]-2-methylpropan-2-ol |
| SMILES | CCN(Cc1ccc(Br)cc1[N+](=O)[O-])CC(C)(C)O |
| InChI | InChI=1S/C13H19BrN2O3/c1-4-15(9-13(2,3)17)8-10-5-6-11(14)7-12(10)16(18)19/h5-7,17H,4,8-9H2,1-3H3 |
| InChIKey | ANTYIVLYRCRCRK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|