C9H14N4O2 — CID 62688298
N'-methyl-N'-(3-methyl-5-nitro-2-pyridinyl)ethane-1,2-diamine (PubChem CID 62688298) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is N'-methyl-N'-(3-methyl-5-nitro-2-pyridinyl)ethane-1,2-diamine.
| Compound Name | N'-methyl-N'-(3-methyl-5-nitro-2-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62688298 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | N'-methyl-N'-(3-methyl-5-nitro-2-pyridinyl)ethane-1,2-diamine |
| SMILES | Cc1cc([N+](=O)[O-])cnc1N(C)CCN |
| InChI | InChI=1S/C9H14N4O2/c1-7-5-8(13(14)15)6-11-9(7)12(2)4-3-10/h5-6H,3-4,10H2,1-2H3 |
| InChIKey | BNTMOXRCDFPTHF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|