C12H11F3N4O4S — CID 12895381
[3-(diethylamino)-2,4-dinitro-6-(trifluoromethyl)phenyl] thiocyanate (PubChem CID 12895381) has the molecular formula C12H11F3N4O4S and a molecular weight of 364.31 g/mol. Its IUPAC name is [3-(diethylamino)-2,4-dinitro-6-(trifluoromethyl)phenyl] thiocyanate.
| Compound Name | [3-(diethylamino)-2,4-dinitro-6-(trifluoromethyl)phenyl] thiocyanate |
|---|---|
| PubChem CID | 12895381 |
| Molecular Formula | C12H11F3N4O4S |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | [3-(diethylamino)-2,4-dinitro-6-(trifluoromethyl)phenyl] thiocyanate |
| SMILES | CCN(CC)c1c([N+](=O)[O-])cc(C(F)(F)F)c(SC#N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11F3N4O4S/c1-3-17(4-2)9-8(18(20)21)5-7(12(13,14)15)11(24-6-16)10(9)19(22)23/h5H,3-4H2,1-2H3 |
| InChIKey | NZHWNKYIEXOVQY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 113.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|