C9H7F3N6O4 — CID 12895354
3-azido-N,N-dimethyl-2,6-dinitro-4-(trifluoromethyl)aniline (PubChem CID 12895354) has the molecular formula C9H7F3N6O4 and a molecular weight of 320.19 g/mol. Its IUPAC name is 3-azido-N,N-dimethyl-2,6-dinitro-4-(trifluoromethyl)aniline.
| Compound Name | 3-azido-N,N-dimethyl-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 12895354 |
| Molecular Formula | C9H7F3N6O4 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 3-azido-N,N-dimethyl-2,6-dinitro-4-(trifluoromethyl)aniline |
| SMILES | CN(C)c1c([N+](=O)[O-])cc(C(F)(F)F)c(N=[N+]=[N-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7F3N6O4/c1-16(2)7-5(17(19)20)3-4(9(10,11)12)6(14-15-13)8(7)18(21)22/h3H,1-2H3 |
| InChIKey | QJQTYPGNGXEDPO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 138.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|