C8HBrF6N2O4 — CID 118480839
4-bromo-1,2-dinitro-3,5-bis(trifluoromethyl)benzene (PubChem CID 118480839) has the molecular formula C8HBrF6N2O4 and a molecular weight of 383.00 g/mol. Its IUPAC name is 4-bromo-1,2-dinitro-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 4-bromo-1,2-dinitro-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 118480839 |
| Molecular Formula | C8HBrF6N2O4 |
| Molecular Weight | 383.00 g/mol |
| Exact Mass | 381.90 |
| IUPAC Name | 4-bromo-1,2-dinitro-3,5-bis(trifluoromethyl)benzene |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c(Br)c(C(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8HBrF6N2O4/c9-5-2(7(10,11)12)1-3(16(18)19)6(17(20)21)4(5)8(13,14)15/h1H |
| InChIKey | ZPILZWWNVKKIID-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.00 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|