C7H2F4N2O6S — CID 45274637
3,4-dinitro-5-(trifluoromethyl)benzenesulfonyl fluoride (PubChem CID 45274637) has the molecular formula C7H2F4N2O6S and a molecular weight of 318.16 g/mol. Its IUPAC name is 3,4-dinitro-5-(trifluoromethyl)benzenesulfonyl fluoride.
| Compound Name | 3,4-dinitro-5-(trifluoromethyl)benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 45274637 |
| Molecular Formula | C7H2F4N2O6S |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | 3,4-dinitro-5-(trifluoromethyl)benzenesulfonyl fluoride |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)F)cc(C(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H2F4N2O6S/c8-7(9,10)4-1-3(20(11,18)19)2-5(12(14)15)6(4)13(16)17/h1-2H |
| InChIKey | KCTAYHDNQRCDOJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|