C7H3F3N2O7S — CID 15607727
2,6-dinitro-4-(trifluoromethylsulfonyl)phenol (PubChem CID 15607727) has the molecular formula C7H3F3N2O7S and a molecular weight of 316.17 g/mol. Its IUPAC name is 2,6-dinitro-4-(trifluoromethylsulfonyl)phenol.
| Compound Name | 2,6-dinitro-4-(trifluoromethylsulfonyl)phenol |
|---|---|
| PubChem CID | 15607727 |
| Molecular Formula | C7H3F3N2O7S |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | 2,6-dinitro-4-(trifluoromethylsulfonyl)phenol |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)C(F)(F)F)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C7H3F3N2O7S/c8-7(9,10)20(18,19)3-1-4(11(14)15)6(13)5(2-3)12(16)17/h1-2,13H |
| InChIKey | MCFYWTSXQOLXTM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|