C14H10F3N3O6S — CID 54423870
1-(4-hydroxy-3-nitrophenyl)-3-[4-(trifluoromethylsulfonyl)phenyl]urea (PubChem CID 54423870) has the molecular formula C14H10F3N3O6S and a molecular weight of 405.31 g/mol. Its IUPAC name is 1-(4-hydroxy-3-nitrophenyl)-3-[4-(trifluoromethylsulfonyl)phenyl]urea.
| Compound Name | 1-(4-hydroxy-3-nitrophenyl)-3-[4-(trifluoromethylsulfonyl)phenyl]urea |
|---|---|
| PubChem CID | 54423870 |
| Molecular Formula | C14H10F3N3O6S |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 1-(4-hydroxy-3-nitrophenyl)-3-[4-(trifluoromethylsulfonyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(S(=O)(=O)C(F)(F)F)cc1)Nc1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H10F3N3O6S/c15-14(16,17)27(25,26)10-4-1-8(2-5-10)18-13(22)19-9-3-6-12(21)11(7-9)20(23)24/h1-7,21H,(H2,18,19,22) |
| InChIKey | WCRTUBMRGSCQGE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|