C20H11F6N3O5S — CID 58639482
2-nitro-4-[3-(trifluoromethyl)-2-pyridinyl]-N-[4-(trifluoromethylsulfonyl)phenyl]benzamide (PubChem CID 58639482) has the molecular formula C20H11F6N3O5S and a molecular weight of 519.38 g/mol. Its IUPAC name is 2-nitro-4-[3-(trifluoromethyl)-2-pyridinyl]-N-[4-(trifluoromethylsulfonyl)phenyl]benzamide.
| Compound Name | 2-nitro-4-[3-(trifluoromethyl)-2-pyridinyl]-N-[4-(trifluoromethylsulfonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 58639482 |
| Molecular Formula | C20H11F6N3O5S |
| Molecular Weight | 519.38 g/mol |
| Exact Mass | 519.03 |
| IUPAC Name | 2-nitro-4-[3-(trifluoromethyl)-2-pyridinyl]-N-[4-(trifluoromethylsulfonyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)C(F)(F)F)cc1)c1ccc(-c2ncccc2C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H11F6N3O5S/c21-19(22,23)15-2-1-9-27-17(15)11-3-8-14(16(10-11)29(31)32)18(30)28-12-4-6-13(7-5-12)35(33,34)20(24,25)26/h1-10H,(H,28,30) |
| InChIKey | PMXVWZQIQUVVPM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|