C16H11F7N2O6S2 — CID 19433201
[4-[[4-(trifluoromethylsulfonyl)phenyl]carbamoylamino]phenyl] 1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 19433201) has the molecular formula C16H11F7N2O6S2 and a molecular weight of 524.39 g/mol. Its IUPAC name is [4-[[4-(trifluoromethylsulfonyl)phenyl]carbamoylamino]phenyl] 1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | [4-[[4-(trifluoromethylsulfonyl)phenyl]carbamoylamino]phenyl] 1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 19433201 |
| Molecular Formula | C16H11F7N2O6S2 |
| Molecular Weight | 524.39 g/mol |
| Exact Mass | 523.99 |
| IUPAC Name | [4-[[4-(trifluoromethylsulfonyl)phenyl]carbamoylamino]phenyl] 1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | O=C(Nc1ccc(OS(=O)(=O)C(F)(F)C(F)F)cc1)Nc1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H11F7N2O6S2/c17-13(18)15(19,20)33(29,30)31-11-5-1-9(2-6-11)24-14(26)25-10-3-7-12(8-4-10)32(27,28)16(21,22)23/h1-8,13H,(H2,24,25,26) |
| InChIKey | MGCZLYYJANDPRA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|