C21H14F5NO4S — CID 173419031
3-[4-(difluoromethoxy)phenyl]-N-[4-(trifluoromethylsulfonyl)phenyl]benzamide (PubChem CID 173419031) has the molecular formula C21H14F5NO4S and a molecular weight of 471.40 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-N-[4-(trifluoromethylsulfonyl)phenyl]benzamide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-N-[4-(trifluoromethylsulfonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 173419031 |
| Molecular Formula | C21H14F5NO4S |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-N-[4-(trifluoromethylsulfonyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)C(F)(F)F)cc1)c1cccc(-c2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C21H14F5NO4S/c22-20(23)31-17-8-4-13(5-9-17)14-2-1-3-15(12-14)19(28)27-16-6-10-18(11-7-16)32(29,30)21(24,25)26/h1-12,20H,(H,27,28) |
| InChIKey | WLMGHGZRZINXFK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |