C16H16F2N2O4S — CID 9405047
N-[4-(difluoromethoxy)phenyl]-4-(ethylsulfamoyl)benzamide (PubChem CID 9405047) has the molecular formula C16H16F2N2O4S and a molecular weight of 370.38 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-4-(ethylsulfamoyl)benzamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-4-(ethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 9405047 |
| Molecular Formula | C16H16F2N2O4S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-4-(ethylsulfamoyl)benzamide |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)Nc2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H16F2N2O4S/c1-2-19-25(22,23)14-9-3-11(4-10-14)15(21)20-12-5-7-13(8-6-12)24-16(17)18/h3-10,16,19H,2H2,1H3,(H,20,21) |
| InChIKey | YQYWCDXSVXNZDM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |