C21H24F2N2O4S — CID 26524631
N-[4-(difluoromethoxy)phenyl]-3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzamide (PubChem CID 26524631) has the molecular formula C21H24F2N2O4S and a molecular weight of 438.50 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 26524631 |
| Molecular Formula | C21H24F2N2O4S |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzamide |
| SMILES | C[C@H]1C[C@H](C)CN(S(=O)(=O)c2cccc(C(=O)Nc3ccc(OC(F)F)cc3)c2)C1 |
| InChI | InChI=1S/C21H24F2N2O4S/c1-14-10-15(2)13-25(12-14)30(27,28)19-5-3-4-16(11-19)20(26)24-17-6-8-18(9-7-17)29-21(22)23/h3-9,11,14-15,21H,10,12-13H2,1-2H3,(H,24,26)/t14-,15-/m0/s1 |
| InChIKey | ZSHVPXDUIAQYHW-GJZGRUSLSA-N |
| XLogP | 4.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |