C27H20Cl2N6O6 — CID 171978346
1-(4-chlorophenyl)-3-[4-[[4-[(4-chlorophenyl)carbamoylamino]-2-nitrophenyl]methyl]-3-nitrophenyl]urea (PubChem CID 171978346) has the molecular formula C27H20Cl2N6O6 and a molecular weight of 595.40 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-[[4-[(4-chlorophenyl)carbamoylamino]-2-nitrophenyl]methyl]-3-nitrophenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[4-[[4-[(4-chlorophenyl)carbamoylamino]-2-nitrophenyl]methyl]-3-nitrophenyl]urea |
|---|---|
| PubChem CID | 171978346 |
| Molecular Formula | C27H20Cl2N6O6 |
| Molecular Weight | 595.40 g/mol |
| Exact Mass | 594.08 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-[[4-[(4-chlorophenyl)carbamoylamino]-2-nitrophenyl]methyl]-3-nitrophenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1ccc(Cc2ccc(NC(=O)Nc3ccc(Cl)cc3)cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H20Cl2N6O6/c28-18-3-9-20(10-4-18)30-26(36)32-22-7-1-16(24(14-22)34(38)39)13-17-2-8-23(15-25(17)35(40)41)33-27(37)31-21-11-5-19(29)6-12-21/h1-12,14-15H,13H2,(H2,30,32,36)(H2,31,33,37) |
| InChIKey | JOQDNJSAMKPDIS-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 168.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.40 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|