C13H14N2O4 — CID 99718466
cis-(1R,2S)-2-cyclopropyl-N-(4-hydroxy-3-nitrophenyl)cyclopropane-1-carboxamide (PubChem CID 99718466) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is cis-(1R,2S)-2-cyclopropyl-N-(4-hydroxy-3-nitrophenyl)cyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-cyclopropyl-N-(4-hydroxy-3-nitrophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 99718466 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | cis-(1R,2S)-2-cyclopropyl-N-(4-hydroxy-3-nitrophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(O)c([N+](=O)[O-])c1)[C@@H]1C[C@H]1C1CC1 |
| InChI | InChI=1S/C13H14N2O4/c16-12-4-3-8(5-11(12)15(18)19)14-13(17)10-6-9(10)7-1-2-7/h3-5,7,9-10,16H,1-2,6H2,(H,14,17)/t9-,10+/m0/s1 |
| InChIKey | IRKIQWDTEWMNJQ-VHSXEESVSA-N |
| XLogP | 2.29 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|