C13H16N2O5 — CID 99718437
N-(4-hydroxy-3-nitrophenyl)-2-[(2R)-oxan-2-yl]acetamide (PubChem CID 99718437) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is N-(4-hydroxy-3-nitrophenyl)-2-[(2R)-oxan-2-yl]acetamide.
| Compound Name | N-(4-hydroxy-3-nitrophenyl)-2-[(2R)-oxan-2-yl]acetamide |
|---|---|
| PubChem CID | 99718437 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | N-(4-hydroxy-3-nitrophenyl)-2-[(2R)-oxan-2-yl]acetamide |
| SMILES | O=C(C[C@H]1CCCCO1)Nc1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16N2O5/c16-12-5-4-9(7-11(12)15(18)19)14-13(17)8-10-3-1-2-6-20-10/h4-5,7,10,16H,1-3,6,8H2,(H,14,17)/t10-/m1/s1 |
| InChIKey | YQLTWFPCAOBEIT-SNVBAGLBSA-N |
| XLogP | 2.20 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|