C11H12ClN3O4 — CID 113456796
N-(6-chloro-3-nitro-2-pyridinyl)-2-(oxolan-2-yl)acetamide (PubChem CID 113456796) has the molecular formula C11H12ClN3O4 and a molecular weight of 285.69 g/mol. Its IUPAC name is N-(6-chloro-3-nitro-2-pyridinyl)-2-(oxolan-2-yl)acetamide.
| Compound Name | N-(6-chloro-3-nitro-2-pyridinyl)-2-(oxolan-2-yl)acetamide |
|---|---|
| PubChem CID | 113456796 |
| Molecular Formula | C11H12ClN3O4 |
| Molecular Weight | 285.69 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | N-(6-chloro-3-nitro-2-pyridinyl)-2-(oxolan-2-yl)acetamide |
| SMILES | O=C(CC1CCCO1)Nc1nc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12ClN3O4/c12-9-4-3-8(15(17)18)11(13-9)14-10(16)6-7-2-1-5-19-7/h3-4,7H,1-2,5-6H2,(H,13,14,16) |
| InChIKey | OPOKFTJKGOERQP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.69 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|