C14H12Cl3N5O6 — CID 158566145
6-chloro-N-(1,3-dioxolan-2-ylmethyl)-3-nitropyridin-2-amine;2,6-dichloro-3-nitropyridine (PubChem CID 158566145) has the molecular formula C14H12Cl3N5O6 and a molecular weight of 452.64 g/mol. Its IUPAC name is 6-chloro-N-(1,3-dioxolan-2-ylmethyl)-3-nitropyridin-2-amine;2,6-dichloro-3-nitropyridine.
| Compound Name | 6-chloro-N-(1,3-dioxolan-2-ylmethyl)-3-nitropyridin-2-amine;2,6-dichloro-3-nitropyridine |
|---|---|
| PubChem CID | 158566145 |
| Molecular Formula | C14H12Cl3N5O6 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 450.99 |
| IUPAC Name | 6-chloro-N-(1,3-dioxolan-2-ylmethyl)-3-nitropyridin-2-amine;2,6-dichloro-3-nitropyridine |
| SMILES | O=[N+]([O-])c1ccc(Cl)nc1Cl.O=[N+]([O-])c1ccc(Cl)nc1NCC1OCCO1 |
| InChI | InChI=1S/C9H10ClN3O4.C5H2Cl2N2O2/c10-7-2-1-6(13(14)15)9(12-7)11-5-8-16-3-4-17-8;6-4-2-1-3(9(10)11)5(7)8-4/h1-2,8H,3-5H2,(H,11,12);1-2H |
| InChIKey | HRMPXRSQFULQPM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|