C8H9ClN4O4 — CID 106178690
3-[(6-chloro-3-nitro-2-pyridinyl)amino]-2-hydroxypropanamide (PubChem CID 106178690) has the molecular formula C8H9ClN4O4 and a molecular weight of 260.64 g/mol. Its IUPAC name is 3-[(6-chloro-3-nitro-2-pyridinyl)amino]-2-hydroxypropanamide.
| Compound Name | 3-[(6-chloro-3-nitro-2-pyridinyl)amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106178690 |
| Molecular Formula | C8H9ClN4O4 |
| Molecular Weight | 260.64 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 3-[(6-chloro-3-nitro-2-pyridinyl)amino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNc1nc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H9ClN4O4/c9-6-2-1-4(13(16)17)8(12-6)11-3-5(14)7(10)15/h1-2,5,14H,3H2,(H2,10,15)(H,11,12) |
| InChIKey | VAFVIVSDPHNJNP-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 131.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.64 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|