C8H5ClF3N3O3 — CID 113456785
N-(6-chloro-3-nitro-2-pyridinyl)-3,3,3-trifluoropropanamide (PubChem CID 113456785) has the molecular formula C8H5ClF3N3O3 and a molecular weight of 283.59 g/mol. Its IUPAC name is N-(6-chloro-3-nitro-2-pyridinyl)-3,3,3-trifluoropropanamide.
| Compound Name | N-(6-chloro-3-nitro-2-pyridinyl)-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 113456785 |
| Molecular Formula | C8H5ClF3N3O3 |
| Molecular Weight | 283.59 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | N-(6-chloro-3-nitro-2-pyridinyl)-3,3,3-trifluoropropanamide |
| SMILES | O=C(CC(F)(F)F)Nc1nc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H5ClF3N3O3/c9-5-2-1-4(15(17)18)7(13-5)14-6(16)3-8(10,11)12/h1-2H,3H2,(H,13,14,16) |
| InChIKey | SFVAUYWPLGLUDX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.59 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|