C18H24N6O6 — CID 160851198
N-(1,3-dioxolan-2-ylmethyl)-3-nitropyridin-2-amine;2-N-(1,3-dioxolan-2-ylmethyl)pyridine-2,3-diamine (PubChem CID 160851198) has the molecular formula C18H24N6O6 and a molecular weight of 420.43 g/mol. Its IUPAC name is N-(1,3-dioxolan-2-ylmethyl)-3-nitropyridin-2-amine;2-N-(1,3-dioxolan-2-ylmethyl)pyridine-2,3-diamine.
| Compound Name | N-(1,3-dioxolan-2-ylmethyl)-3-nitropyridin-2-amine;2-N-(1,3-dioxolan-2-ylmethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 160851198 |
| Molecular Formula | C18H24N6O6 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-(1,3-dioxolan-2-ylmethyl)-3-nitropyridin-2-amine;2-N-(1,3-dioxolan-2-ylmethyl)pyridine-2,3-diamine |
| SMILES | Nc1cccnc1NCC1OCCO1.O=[N+]([O-])c1cccnc1NCC1OCCO1 |
| InChI | InChI=1S/C9H11N3O4.C9H13N3O2/c13-12(14)7-2-1-3-10-9(7)11-6-8-15-4-5-16-8;10-7-2-1-3-11-9(7)12-6-8-13-4-5-14-8/h1-3,8H,4-6H2,(H,10,11);1-3,8H,4-6,10H2,(H,11,12) |
| InChIKey | SJHAHGRCVUGTOB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|