C11H13ClN4O3 — CID 79401201
3-[(6-chloro-3-nitro-2-pyridinyl)amino]-N-cyclopropylpropanamide (PubChem CID 79401201) has the molecular formula C11H13ClN4O3 and a molecular weight of 284.70 g/mol. Its IUPAC name is 3-[(6-chloro-3-nitro-2-pyridinyl)amino]-N-cyclopropylpropanamide.
| Compound Name | 3-[(6-chloro-3-nitro-2-pyridinyl)amino]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 79401201 |
| Molecular Formula | C11H13ClN4O3 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 3-[(6-chloro-3-nitro-2-pyridinyl)amino]-N-cyclopropylpropanamide |
| SMILES | O=C(CCNc1nc(Cl)ccc1[N+](=O)[O-])NC1CC1 |
| InChI | InChI=1S/C11H13ClN4O3/c12-9-4-3-8(16(18)19)11(15-9)13-6-5-10(17)14-7-1-2-7/h3-4,7H,1-2,5-6H2,(H,13,15)(H,14,17) |
| InChIKey | XWZPKQGEIIZVQB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|