C15H17NO3 — CID 75482501
2-[3-[(2-cyclopropylcyclopropanecarbonyl)amino]phenyl]acetic acid (PubChem CID 75482501) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-[3-[(2-cyclopropylcyclopropanecarbonyl)amino]phenyl]acetic acid.
| Compound Name | 2-[3-[(2-cyclopropylcyclopropanecarbonyl)amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 75482501 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-[3-[(2-cyclopropylcyclopropanecarbonyl)amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(NC(=O)C2CC2C2CC2)c1 |
| InChI | InChI=1S/C15H17NO3/c17-14(18)7-9-2-1-3-11(6-9)16-15(19)13-8-12(13)10-4-5-10/h1-3,6,10,12-13H,4-5,7-8H2,(H,16,19)(H,17,18) |
| InChIKey | MSAITIVKJCLANP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |