C19H25NO3 — CID 120530686
2-[3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonylamino)phenyl]acetic acid (PubChem CID 120530686) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 2-[3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonylamino)phenyl]acetic acid.
| Compound Name | 2-[3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonylamino)phenyl]acetic acid |
|---|---|
| PubChem CID | 120530686 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-[3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonylamino)phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(NC(=O)C2CCC3CCCCC3C2)c1 |
| InChI | InChI=1S/C19H25NO3/c21-18(22)11-13-4-3-7-17(10-13)20-19(23)16-9-8-14-5-1-2-6-15(14)12-16/h3-4,7,10,14-16H,1-2,5-6,8-9,11-12H2,(H,20,23)(H,21,22) |
| InChIKey | SHUKVEHDQVHDLB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |