C8H2ClF6NO6S2 — CID 2304981
2-chloro-1-nitro-3,5-bis(trifluoromethylsulfonyl)benzene (PubChem CID 2304981) has the molecular formula C8H2ClF6NO6S2 and a molecular weight of 421.68 g/mol. Its IUPAC name is 2-chloro-1-nitro-3,5-bis(trifluoromethylsulfonyl)benzene.
| Compound Name | 2-chloro-1-nitro-3,5-bis(trifluoromethylsulfonyl)benzene |
|---|---|
| PubChem CID | 2304981 |
| Molecular Formula | C8H2ClF6NO6S2 |
| Molecular Weight | 421.68 g/mol |
| Exact Mass | 420.89 |
| IUPAC Name | 2-chloro-1-nitro-3,5-bis(trifluoromethylsulfonyl)benzene |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)C(F)(F)F)cc(S(=O)(=O)C(F)(F)F)c1Cl |
| InChI | InChI=1S/C8H2ClF6NO6S2/c9-6-4(16(17)18)1-3(23(19,20)7(10,11)12)2-5(6)24(21,22)8(13,14)15/h1-2H |
| InChIKey | XUGHNMYPCVXCFT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 111.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.68 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|