C10H3ClF9NO4S — CID 2909341
1-chloro-4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]sulfonyl-2-nitrobenzene (PubChem CID 2909341) has the molecular formula C10H3ClF9NO4S and a molecular weight of 439.64 g/mol. Its IUPAC name is 1-chloro-4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]sulfonyl-2-nitrobenzene.
| Compound Name | 1-chloro-4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]sulfonyl-2-nitrobenzene |
|---|---|
| PubChem CID | 2909341 |
| Molecular Formula | C10H3ClF9NO4S |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 438.93 |
| IUPAC Name | 1-chloro-4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]sulfonyl-2-nitrobenzene |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C10H3ClF9NO4S/c11-5-2-1-4(3-6(5)21(22)23)26(24,25)7(8(12,13)14,9(15,16)17)10(18,19)20/h1-3H |
| InChIKey | QXMUTRARPSEJJF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|