About sodium;4-(benzenesulfonyl)-1-chloro-2-nitrobenzene;nitrite
sodium;4-(benzenesulfonyl)-1-chloro-2-nitrobenzene;nitrite (PubChem CID 158164273) has the molecular formula C12H8ClN2NaO6S
and a molecular weight of 366.71 g/mol. Its IUPAC name is sodium;4-(benzenesulfonyl)-1-chloro-2-nitrobenzene;nitrite.
Molecular Properties
| Compound Name | sodium;4-(benzenesulfonyl)-1-chloro-2-nitrobenzene;nitrite |
| PubChem CID | 158164273 |
| Molecular Formula | C12H8ClN2NaO6S |
| Molecular Weight | 366.71 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | sodium;4-(benzenesulfonyl)-1-chloro-2-nitrobenzene;nitrite |
| SMILES | O=N[O-].O=[N+]([O-])c1cc(S(=O)(=O)c2ccccc2)ccc1Cl.[Na+] |
| InChI | InChI=1S/C12H8ClNO4S.HNO2.Na/c13-11-7-6-10(8-12(11)14(15)16)19(17,18)9-4-2-1-3-5-9;2-1-3;/h1-8H;(H,2,3);/q;;+1/p-1 |
| InChIKey | HYQBCRIPHLUNJL-UHFFFAOYSA-M |
| XLogP | 0.34 |
| TPSA | 129.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.71 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;4-(benzenesulfonyl)-1-chloro-2-nitrobenzene;nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-(benzenesulfonyl)-1-chloro-2-nitrobenzene;nitrite?
The IUPAC name of sodium;4-(benzenesulfonyl)-1-chloro-2-nitrobenzene;nitrite (CID 158164273) is sodium;4-(benzenesulfonyl)-1-chloro-2-nitrobenzene;nitrite.
What is the SMILES notation for sodium;4-(benzenesulfonyl)-1-chloro-2-nitrobenzene;nitrite?
The canonical SMILES for sodium;4-(benzenesulfonyl)-1-chloro-2-nitrobenzene;nitrite is O=N[O-].O=[N+]([O-])c1cc(S(=O)(=O)c2ccccc2)ccc1Cl.[Na+].
What is the InChIKey of sodium;4-(benzenesulfonyl)-1-chloro-2-nitrobenzene;nitrite?
The InChIKey is HYQBCRIPHLUNJL-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H8ClNO4S.HNO2.Na/c13-11-7-6-10(8-12(11)14(15)16)19(17,18)9-4-2-1-3-5-9;2-1-3;/h1-8H;(H,2,3);/q;;+1/p-1.
What are the key properties of sodium;4-(benzenesulfonyl)-1-chloro-2-nitrobenzene;nitrite?
sodium;4-(benzenesulfonyl)-1-chloro-2-nitrobenzene;nitrite has a molecular weight of 366.71 g/mol, XLogP of 0.34, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-(benzenesulfonyl)-1-chloro-2-nitrobenzene;nitrite is sourced from PubChem (CID 158164273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).