About potassium;4-chloro-3-nitrobenzenesulfonate;4-chloro-3-nitrobenzenesulfonyl chloride
potassium;4-chloro-3-nitrobenzenesulfonate;4-chloro-3-nitrobenzenesulfonyl chloride (PubChem CID 159793173) has the molecular formula C12H6Cl3KN2O9S2
and a molecular weight of 531.78 g/mol. Its IUPAC name is potassium;4-chloro-3-nitrobenzenesulfonate;4-chloro-3-nitrobenzenesulfonyl chloride.
Molecular Properties
| Compound Name | potassium;4-chloro-3-nitrobenzenesulfonate;4-chloro-3-nitrobenzenesulfonyl chloride |
| PubChem CID | 159793173 |
| Molecular Formula | C12H6Cl3KN2O9S2 |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 529.82 |
| IUPAC Name | potassium;4-chloro-3-nitrobenzenesulfonate;4-chloro-3-nitrobenzenesulfonyl chloride |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Cl)ccc1Cl.O=[N+]([O-])c1cc(S(=O)(=O)[O-])ccc1Cl.[K+] |
| InChI | InChI=1S/C6H3Cl2NO4S.C6H4ClNO5S.K/c7-5-2-1-4(14(8,12)13)3-6(5)9(10)11;7-5-2-1-4(14(11,12)13)3-6(5)8(9)10;/h1-3H;1-3H,(H,11,12,13);/q;;+1/p-1 |
| InChIKey | VJLWTZVLAQFHHW-UHFFFAOYSA-M |
| XLogP | 0.33 |
| TPSA | 177.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;4-chloro-3-nitrobenzenesulfonate;4-chloro-3-nitrobenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;4-chloro-3-nitrobenzenesulfonate;4-chloro-3-nitrobenzenesulfonyl chloride?
The IUPAC name of potassium;4-chloro-3-nitrobenzenesulfonate;4-chloro-3-nitrobenzenesulfonyl chloride (CID 159793173) is potassium;4-chloro-3-nitrobenzenesulfonate;4-chloro-3-nitrobenzenesulfonyl chloride.
What is the SMILES notation for potassium;4-chloro-3-nitrobenzenesulfonate;4-chloro-3-nitrobenzenesulfonyl chloride?
The canonical SMILES for potassium;4-chloro-3-nitrobenzenesulfonate;4-chloro-3-nitrobenzenesulfonyl chloride is O=[N+]([O-])c1cc(S(=O)(=O)Cl)ccc1Cl.O=[N+]([O-])c1cc(S(=O)(=O)[O-])ccc1Cl.[K+].
What is the InChIKey of potassium;4-chloro-3-nitrobenzenesulfonate;4-chloro-3-nitrobenzenesulfonyl chloride?
The InChIKey is VJLWTZVLAQFHHW-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H3Cl2NO4S.C6H4ClNO5S.K/c7-5-2-1-4(14(8,12)13)3-6(5)9(10)11;7-5-2-1-4(14(11,12)13)3-6(5)8(9)10;/h1-3H;1-3H,(H,11,12,13);/q;;+1/p-1.
What are the key properties of potassium;4-chloro-3-nitrobenzenesulfonate;4-chloro-3-nitrobenzenesulfonyl chloride?
potassium;4-chloro-3-nitrobenzenesulfonate;4-chloro-3-nitrobenzenesulfonyl chloride has a molecular weight of 531.78 g/mol, XLogP of 0.33, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;4-chloro-3-nitrobenzenesulfonate;4-chloro-3-nitrobenzenesulfonyl chloride is sourced from PubChem (CID 159793173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).