C8H3ClF6O4S2 — CID 3496072
1-chloro-2,4-bis(trifluoromethylsulfonyl)benzene (PubChem CID 3496072) has the molecular formula C8H3ClF6O4S2 and a molecular weight of 376.68 g/mol. Its IUPAC name is 1-chloro-2,4-bis(trifluoromethylsulfonyl)benzene.
| Compound Name | 1-chloro-2,4-bis(trifluoromethylsulfonyl)benzene |
|---|---|
| PubChem CID | 3496072 |
| Molecular Formula | C8H3ClF6O4S2 |
| Molecular Weight | 376.68 g/mol |
| Exact Mass | 375.91 |
| IUPAC Name | 1-chloro-2,4-bis(trifluoromethylsulfonyl)benzene |
| SMILES | O=S(=O)(c1ccc(Cl)c(S(=O)(=O)C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C8H3ClF6O4S2/c9-5-2-1-4(20(16,17)7(10,11)12)3-6(5)21(18,19)8(13,14)15/h1-3H |
| InChIKey | KFAQIISMTQOCSF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.68 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |