C9H6F6O5S2 — CID 20665113
2-methyl-4,6-bis(trifluoromethylsulfonyl)phenol (PubChem CID 20665113) has the molecular formula C9H6F6O5S2 and a molecular weight of 372.26 g/mol. Its IUPAC name is 2-methyl-4,6-bis(trifluoromethylsulfonyl)phenol.
| Compound Name | 2-methyl-4,6-bis(trifluoromethylsulfonyl)phenol |
|---|---|
| PubChem CID | 20665113 |
| Molecular Formula | C9H6F6O5S2 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | 2-methyl-4,6-bis(trifluoromethylsulfonyl)phenol |
| SMILES | Cc1cc(S(=O)(=O)C(F)(F)F)cc(S(=O)(=O)C(F)(F)F)c1O |
| InChI | InChI=1S/C9H6F6O5S2/c1-4-2-5(21(17,18)8(10,11)12)3-6(7(4)16)22(19,20)9(13,14)15/h2-3,16H,1H3 |
| InChIKey | ONICKMGSPPGLQS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |