C8H9FO3S — CID 130033661
4-hydroxy-3,5-dimethylbenzenesulfonyl fluoride (PubChem CID 130033661) has the molecular formula C8H9FO3S and a molecular weight of 204.22 g/mol. Its IUPAC name is 4-hydroxy-3,5-dimethylbenzenesulfonyl fluoride.
| Compound Name | 4-hydroxy-3,5-dimethylbenzenesulfonyl fluoride |
|---|---|
| PubChem CID | 130033661 |
| Molecular Formula | C8H9FO3S |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 4-hydroxy-3,5-dimethylbenzenesulfonyl fluoride |
| SMILES | Cc1cc(S(=O)(=O)F)cc(C)c1O |
| InChI | InChI=1S/C8H9FO3S/c1-5-3-7(13(9,11)12)4-6(2)8(5)10/h3-4,10H,1-2H3 |
| InChIKey | ZIPUMRGZZGNMMK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |