C17H20O4S — CID 101302115
6-(4-hydroxy-3,5-dimethylphenyl)sulfonyl-2,3,4-trimethylphenol (PubChem CID 101302115) has the molecular formula C17H20O4S and a molecular weight of 320.41 g/mol. Its IUPAC name is 6-(4-hydroxy-3,5-dimethylphenyl)sulfonyl-2,3,4-trimethylphenol.
| Compound Name | 6-(4-hydroxy-3,5-dimethylphenyl)sulfonyl-2,3,4-trimethylphenol |
|---|---|
| PubChem CID | 101302115 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 6-(4-hydroxy-3,5-dimethylphenyl)sulfonyl-2,3,4-trimethylphenol |
| SMILES | Cc1cc(S(=O)(=O)c2cc(C)c(O)c(C)c2)c(O)c(C)c1C |
| InChI | InChI=1S/C17H20O4S/c1-9-8-15(17(19)13(5)12(9)4)22(20,21)14-6-10(2)16(18)11(3)7-14/h6-8,18-19H,1-5H3 |
| InChIKey | BSLVQFNJNBWHAY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |