C11H16O4S — CID 175309410
propyl 4-hydroxy-3,5-dimethylbenzenesulfonate (PubChem CID 175309410) has the molecular formula C11H16O4S and a molecular weight of 244.31 g/mol. Its IUPAC name is propyl 4-hydroxy-3,5-dimethylbenzenesulfonate.
| Compound Name | propyl 4-hydroxy-3,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 175309410 |
| Molecular Formula | C11H16O4S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | propyl 4-hydroxy-3,5-dimethylbenzenesulfonate |
| SMILES | CCCOS(=O)(=O)c1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C11H16O4S/c1-4-5-15-16(13,14)10-6-8(2)11(12)9(3)7-10/h6-7,12H,4-5H2,1-3H3 |
| InChIKey | DJUAUEDAXQBHMW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|