C13H20O5S — CID 175217951
propyl 3-(2-methoxyethoxy)-4-methylbenzenesulfonate (PubChem CID 175217951) has the molecular formula C13H20O5S and a molecular weight of 288.37 g/mol. Its IUPAC name is propyl 3-(2-methoxyethoxy)-4-methylbenzenesulfonate.
| Compound Name | propyl 3-(2-methoxyethoxy)-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 175217951 |
| Molecular Formula | C13H20O5S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | propyl 3-(2-methoxyethoxy)-4-methylbenzenesulfonate |
| SMILES | CCCOS(=O)(=O)c1ccc(C)c(OCCOC)c1 |
| InChI | InChI=1S/C13H20O5S/c1-4-7-18-19(14,15)12-6-5-11(2)13(10-12)17-9-8-16-3/h5-6,10H,4,7-9H2,1-3H3 |
| InChIKey | ZPJRPBKTTVRPKT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|