C13H9F9O8S3 — CID 12586096
ethyl 2-[2,4,6-tris(trifluoromethylsulfonyl)phenyl]acetate (PubChem CID 12586096) has the molecular formula C13H9F9O8S3 and a molecular weight of 560.39 g/mol. Its IUPAC name is ethyl 2-[2,4,6-tris(trifluoromethylsulfonyl)phenyl]acetate.
| Compound Name | ethyl 2-[2,4,6-tris(trifluoromethylsulfonyl)phenyl]acetate |
|---|---|
| PubChem CID | 12586096 |
| Molecular Formula | C13H9F9O8S3 |
| Molecular Weight | 560.39 g/mol |
| Exact Mass | 559.93 |
| IUPAC Name | ethyl 2-[2,4,6-tris(trifluoromethylsulfonyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1c(S(=O)(=O)C(F)(F)F)cc(S(=O)(=O)C(F)(F)F)cc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H9F9O8S3/c1-2-30-10(23)5-7-8(32(26,27)12(17,18)19)3-6(31(24,25)11(14,15)16)4-9(7)33(28,29)13(20,21)22/h3-4H,2,5H2,1H3 |
| InChIKey | LTBSREHBNXNLEY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 128.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |