C12H10F6O3 — CID 134639188
ethyl 2-[6-hydroxy-2,3-bis(trifluoromethyl)phenyl]acetate (PubChem CID 134639188) has the molecular formula C12H10F6O3 and a molecular weight of 316.20 g/mol. Its IUPAC name is ethyl 2-[6-hydroxy-2,3-bis(trifluoromethyl)phenyl]acetate.
| Compound Name | ethyl 2-[6-hydroxy-2,3-bis(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 134639188 |
| Molecular Formula | C12H10F6O3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | ethyl 2-[6-hydroxy-2,3-bis(trifluoromethyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1c(O)ccc(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C12H10F6O3/c1-2-21-9(20)5-6-8(19)4-3-7(11(13,14)15)10(6)12(16,17)18/h3-4,19H,2,5H2,1H3 |
| InChIKey | MIESATKVLVMEIE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |