C8H4F6O5S2 — CID 1288911
3,5-bis(trifluoromethylsulfonyl)phenol (PubChem CID 1288911) has the molecular formula C8H4F6O5S2 and a molecular weight of 358.24 g/mol. Its IUPAC name is 3,5-bis(trifluoromethylsulfonyl)phenol.
| Compound Name | 3,5-bis(trifluoromethylsulfonyl)phenol |
|---|---|
| PubChem CID | 1288911 |
| Molecular Formula | C8H4F6O5S2 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.94 |
| IUPAC Name | 3,5-bis(trifluoromethylsulfonyl)phenol |
| SMILES | O=S(=O)(c1cc(O)cc(S(=O)(=O)C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C8H4F6O5S2/c9-7(10,11)20(16,17)5-1-4(15)2-6(3-5)21(18,19)8(12,13)14/h1-3,15H |
| InChIKey | MKTRVRROXMEBQR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |