About bis(3-(trifluoromethylsulfonyl)phenol);zirconium
bis(3-(trifluoromethylsulfonyl)phenol);zirconium (PubChem CID 161276997) has the molecular formula C14H10F6O6S2Zr
and a molecular weight of 543.57 g/mol. Its IUPAC name is bis(3-(trifluoromethylsulfonyl)phenol);zirconium.
Molecular Properties
| Compound Name | bis(3-(trifluoromethylsulfonyl)phenol);zirconium |
| PubChem CID | 161276997 |
| Molecular Formula | C14H10F6O6S2Zr |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 541.89 |
| IUPAC Name | bis(3-(trifluoromethylsulfonyl)phenol);zirconium |
| SMILES | O=S(=O)(c1cccc(O)c1)C(F)(F)F.O=S(=O)(c1cccc(O)c1)C(F)(F)F.[Zr] |
| InChI | InChI=1S/2C7H5F3O3S.Zr/c2*8-7(9,10)14(12,13)6-3-1-2-5(11)4-6;/h2*1-4,11H; |
| InChIKey | UKAIAUPVXLNCTE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(3-(trifluoromethylsulfonyl)phenol);zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-(trifluoromethylsulfonyl)phenol);zirconium?
The IUPAC name of bis(3-(trifluoromethylsulfonyl)phenol);zirconium (CID 161276997) is bis(3-(trifluoromethylsulfonyl)phenol);zirconium.
What is the SMILES notation for bis(3-(trifluoromethylsulfonyl)phenol);zirconium?
The canonical SMILES for bis(3-(trifluoromethylsulfonyl)phenol);zirconium is O=S(=O)(c1cccc(O)c1)C(F)(F)F.O=S(=O)(c1cccc(O)c1)C(F)(F)F.[Zr].
What is the InChIKey of bis(3-(trifluoromethylsulfonyl)phenol);zirconium?
The InChIKey is UKAIAUPVXLNCTE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H5F3O3S.Zr/c2*8-7(9,10)14(12,13)6-3-1-2-5(11)4-6;/h2*1-4,11H;.
What are the key properties of bis(3-(trifluoromethylsulfonyl)phenol);zirconium?
bis(3-(trifluoromethylsulfonyl)phenol);zirconium has a molecular weight of 543.57 g/mol, XLogP of 3.37, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-(trifluoromethylsulfonyl)phenol);zirconium is sourced from PubChem (CID 161276997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).