C8H8F2O3S — CID 84687411
3-(2,2-difluoroethylsulfonyl)phenol (PubChem CID 84687411) has the molecular formula C8H8F2O3S and a molecular weight of 222.21 g/mol. Its IUPAC name is 3-(2,2-difluoroethylsulfonyl)phenol.
| Compound Name | 3-(2,2-difluoroethylsulfonyl)phenol |
|---|---|
| PubChem CID | 84687411 |
| Molecular Formula | C8H8F2O3S |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 3-(2,2-difluoroethylsulfonyl)phenol |
| SMILES | O=S(=O)(CC(F)F)c1cccc(O)c1 |
| InChI | InChI=1S/C8H8F2O3S/c9-8(10)5-14(12,13)7-3-1-2-6(11)4-7/h1-4,8,11H,5H2 |
| InChIKey | GERRESAKFXLKFT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |