C9H11NO5S — CID 139485959
2-(3-hydroxyphenyl)sulfonylethylcarbamic acid (PubChem CID 139485959) has the molecular formula C9H11NO5S and a molecular weight of 245.26 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)sulfonylethylcarbamic acid.
| Compound Name | 2-(3-hydroxyphenyl)sulfonylethylcarbamic acid |
|---|---|
| PubChem CID | 139485959 |
| Molecular Formula | C9H11NO5S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-(3-hydroxyphenyl)sulfonylethylcarbamic acid |
| SMILES | O=C(O)NCCS(=O)(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C9H11NO5S/c11-7-2-1-3-8(6-7)16(14,15)5-4-10-9(12)13/h1-3,6,10-11H,4-5H2,(H,12,13) |
| InChIKey | ZJDWJJVACZKTGD-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |